About 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione
1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione (PubChem CID 63812530) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione |
| PubChem CID | 63812530 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(Cc2ccno2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H7N3O3/c12-7-2-4-11(8(13)10-7)5-6-1-3-9-14-6/h1-4H,5H2,(H,10,12,13) |
| InChIKey | OGJDZKLQRHPCDX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The IUPAC name of 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione (CID 63812530) is 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione is O=c1ccn(Cc2ccno2)c(=O)[nH]1.
What is the InChIKey of 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
The InChIKey is OGJDZKLQRHPCDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c12-7-2-4-11(8(13)10-7)5-6-1-3-9-14-6/h1-4H,5H2,(H,10,12,13).
What are the key properties of 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione?
1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione has a molecular weight of 193.16 g/mol, XLogP of -0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-oxazol-5-ylmethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 63812530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).