About 3-butyl-1-ethylpyrimidine-2,4-dione
3-butyl-1-ethylpyrimidine-2,4-dione (PubChem CID 63812534) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-butyl-1-ethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-butyl-1-ethylpyrimidine-2,4-dione |
| PubChem CID | 63812534 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-butyl-1-ethylpyrimidine-2,4-dione |
| SMILES | CCCCn1c(=O)ccn(CC)c1=O |
| InChI | InChI=1S/C10H16N2O2/c1-3-5-7-12-9(13)6-8-11(4-2)10(12)14/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | UNXIRTYMGCUDNM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-1-ethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1-ethylpyrimidine-2,4-dione?
The IUPAC name of 3-butyl-1-ethylpyrimidine-2,4-dione (CID 63812534) is 3-butyl-1-ethylpyrimidine-2,4-dione.
What is the SMILES notation for 3-butyl-1-ethylpyrimidine-2,4-dione?
The canonical SMILES for 3-butyl-1-ethylpyrimidine-2,4-dione is CCCCn1c(=O)ccn(CC)c1=O.
What is the InChIKey of 3-butyl-1-ethylpyrimidine-2,4-dione?
The InChIKey is UNXIRTYMGCUDNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-3-5-7-12-9(13)6-8-11(4-2)10(12)14/h6,8H,3-5,7H2,1-2H3.
What are the key properties of 3-butyl-1-ethylpyrimidine-2,4-dione?
3-butyl-1-ethylpyrimidine-2,4-dione has a molecular weight of 196.25 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1-ethylpyrimidine-2,4-dione is sourced from PubChem (CID 63812534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).