About N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine
N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine (PubChem CID 63812673) has the molecular formula C16H17F2NS
and a molecular weight of 293.38 g/mol. Its IUPAC name is N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine |
| PubChem CID | 63812673 |
| Molecular Formula | C16H17F2NS |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)c(Sc2cccc(C)c2)c(F)c1 |
| InChI | InChI=1S/C16H17F2NS/c1-3-19-10-12-8-14(17)16(15(18)9-12)20-13-6-4-5-11(2)7-13/h4-9,19H,3,10H2,1-2H3 |
| InChIKey | GBSPTMNLGQJINK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine?
The IUPAC name of N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine (CID 63812673) is N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine.
What is the SMILES notation for N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine?
The canonical SMILES for N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine is CCNCc1cc(F)c(Sc2cccc(C)c2)c(F)c1.
What is the InChIKey of N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine?
The InChIKey is GBSPTMNLGQJINK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2NS/c1-3-19-10-12-8-14(17)16(15(18)9-12)20-13-6-4-5-11(2)7-13/h4-9,19H,3,10H2,1-2H3.
What are the key properties of N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine?
N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine has a molecular weight of 293.38 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,5-difluoro-4-(3-methylphenyl)sulfanylphenyl]methyl]ethanamine is sourced from PubChem (CID 63812673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).