C15H15FOS — CID 63813829
[4-(2,4-dimethylphenyl)sulfanyl-3-fluorophenyl]methanol (PubChem CID 63813829) has the molecular formula C15H15FOS and a molecular weight of 262.35 g/mol. Its IUPAC name is [4-(2,4-dimethylphenyl)sulfanyl-3-fluorophenyl]methanol.
| Compound Name | [4-(2,4-dimethylphenyl)sulfanyl-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 63813829 |
| Molecular Formula | C15H15FOS |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [4-(2,4-dimethylphenyl)sulfanyl-3-fluorophenyl]methanol |
| SMILES | Cc1ccc(Sc2ccc(CO)cc2F)c(C)c1 |
| InChI | InChI=1S/C15H15FOS/c1-10-3-5-14(11(2)7-10)18-15-6-4-12(9-17)8-13(15)16/h3-8,17H,9H2,1-2H3 |
| InChIKey | PPGKDLGIDSHCDJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |