About [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol
[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol (PubChem CID 63814019) has the molecular formula C14H14N4OS2
and a molecular weight of 318.43 g/mol. Its IUPAC name is [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol |
| PubChem CID | 63814019 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol |
| SMILES | CN(C)c1nnc(Sc2nc3ccccc3cc2CO)s1 |
| InChI | InChI=1S/C14H14N4OS2/c1-18(2)13-16-17-14(21-13)20-12-10(8-19)7-9-5-3-4-6-11(9)15-12/h3-7,19H,8H2,1-2H3 |
| InChIKey | CFMAIHHTPMVQIH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol?
The IUPAC name of [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol (CID 63814019) is [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol.
What is the SMILES notation for [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol?
The canonical SMILES for [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol is CN(C)c1nnc(Sc2nc3ccccc3cc2CO)s1.
What is the InChIKey of [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol?
The InChIKey is CFMAIHHTPMVQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4OS2/c1-18(2)13-16-17-14(21-13)20-12-10(8-19)7-9-5-3-4-6-11(9)15-12/h3-7,19H,8H2,1-2H3.
What are the key properties of [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol?
[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol has a molecular weight of 318.43 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]quinolin-3-yl]methanol is sourced from PubChem (CID 63814019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).