About [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol (PubChem CID 63814305) has the molecular formula C13H12N4OS
and a molecular weight of 272.33 g/mol. Its IUPAC name is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol |
| PubChem CID | 63814305 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol |
| SMILES | Cn1cnnc1Sc1nc2ccccc2cc1CO |
| InChI | InChI=1S/C13H12N4OS/c1-17-8-14-16-13(17)19-12-10(7-18)6-9-4-2-3-5-11(9)15-12/h2-6,8,18H,7H2,1H3 |
| InChIKey | LJRLRFHPVOEGSE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol?
The IUPAC name of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol (CID 63814305) is [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol.
What is the SMILES notation for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol?
The canonical SMILES for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol is Cn1cnnc1Sc1nc2ccccc2cc1CO.
What is the InChIKey of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol?
The InChIKey is LJRLRFHPVOEGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4OS/c1-17-8-14-16-13(17)19-12-10(7-18)6-9-4-2-3-5-11(9)15-12/h2-6,8,18H,7H2,1H3.
What are the key properties of [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol?
[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol has a molecular weight of 272.33 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinolin-3-yl]methanol is sourced from PubChem (CID 63814305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).