C15H21N5S — CID 63814936
2-[3-methyl-4-(propylaminomethyl)phenyl]sulfanylpyrimidine-4,6-diamine (PubChem CID 63814936) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 2-[3-methyl-4-(propylaminomethyl)phenyl]sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-[3-methyl-4-(propylaminomethyl)phenyl]sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 63814936 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[3-methyl-4-(propylaminomethyl)phenyl]sulfanylpyrimidine-4,6-diamine |
| SMILES | CCCNCc1ccc(Sc2nc(N)cc(N)n2)cc1C |
| InChI | InChI=1S/C15H21N5S/c1-3-6-18-9-11-4-5-12(7-10(11)2)21-15-19-13(16)8-14(17)20-15/h4-5,7-8,18H,3,6,9H2,1-2H3,(H4,16,17,19,20) |
| InChIKey | ARFKDTYTBQDSCF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|