C17H28N2O — CID 63817565
4-(2-aminobutyl)-N,2-dimethyl-N-(oxolan-2-ylmethyl)aniline (PubChem CID 63817565) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-(2-aminobutyl)-N,2-dimethyl-N-(oxolan-2-ylmethyl)aniline.
| Compound Name | 4-(2-aminobutyl)-N,2-dimethyl-N-(oxolan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 63817565 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 4-(2-aminobutyl)-N,2-dimethyl-N-(oxolan-2-ylmethyl)aniline |
| SMILES | CCC(N)Cc1ccc(N(C)CC2CCCO2)c(C)c1 |
| InChI | InChI=1S/C17H28N2O/c1-4-15(18)11-14-7-8-17(13(2)10-14)19(3)12-16-6-5-9-20-16/h7-8,10,15-16H,4-6,9,11-12,18H2,1-3H3 |
| InChIKey | ZOMCEZGBKPOJEI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |