C15H16BrNO2S2 — CID 63818539
2-[4-bromo-2-(4-methylsulfonylphenyl)sulfanylphenyl]ethanamine (PubChem CID 63818539) has the molecular formula C15H16BrNO2S2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 2-[4-bromo-2-(4-methylsulfonylphenyl)sulfanylphenyl]ethanamine.
| Compound Name | 2-[4-bromo-2-(4-methylsulfonylphenyl)sulfanylphenyl]ethanamine |
|---|---|
| PubChem CID | 63818539 |
| Molecular Formula | C15H16BrNO2S2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 2-[4-bromo-2-(4-methylsulfonylphenyl)sulfanylphenyl]ethanamine |
| SMILES | CS(=O)(=O)c1ccc(Sc2cc(Br)ccc2CCN)cc1 |
| InChI | InChI=1S/C15H16BrNO2S2/c1-21(18,19)14-6-4-13(5-7-14)20-15-10-12(16)3-2-11(15)8-9-17/h2-7,10H,8-9,17H2,1H3 |
| InChIKey | UEMSPGZZUMHVIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |