About 6-butyltetrazolo[1,5-a]pyrimidine
6-butyltetrazolo[1,5-a]pyrimidine (PubChem CID 638202) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-butyltetrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 6-butyltetrazolo[1,5-a]pyrimidine |
| PubChem CID | 638202 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-butyltetrazolo[1,5-a]pyrimidine |
| SMILES | CCCCc1cnc2nnnn2c1 |
| InChI | InChI=1S/C8H11N5/c1-2-3-4-7-5-9-8-10-11-12-13(8)6-7/h5-6H,2-4H2,1H3 |
| InChIKey | YOCIRKWUKWJCDV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-butyltetrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyltetrazolo[1,5-a]pyrimidine?
The IUPAC name of 6-butyltetrazolo[1,5-a]pyrimidine (CID 638202) is 6-butyltetrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 6-butyltetrazolo[1,5-a]pyrimidine?
The canonical SMILES for 6-butyltetrazolo[1,5-a]pyrimidine is CCCCc1cnc2nnnn2c1.
What is the InChIKey of 6-butyltetrazolo[1,5-a]pyrimidine?
The InChIKey is YOCIRKWUKWJCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-2-3-4-7-5-9-8-10-11-12-13(8)6-7/h5-6H,2-4H2,1H3.
What are the key properties of 6-butyltetrazolo[1,5-a]pyrimidine?
6-butyltetrazolo[1,5-a]pyrimidine has a molecular weight of 177.21 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyltetrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 638202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).