About 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol
4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 63821752) has the molecular formula C10H11FO
and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 63821752 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC1CC(O)c2cccc(F)c21 |
| InChI | InChI=1S/C10H11FO/c1-6-5-9(12)7-3-2-4-8(11)10(6)7/h2-4,6,9,12H,5H2,1H3 |
| InChIKey | PSVQSZCCQUELOD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol (CID 63821752) is 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol is CC1CC(O)c2cccc(F)c21.
What is the InChIKey of 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is PSVQSZCCQUELOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO/c1-6-5-9(12)7-3-2-4-8(11)10(6)7/h2-4,6,9,12H,5H2,1H3.
What are the key properties of 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol?
4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 166.20 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 63821752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).