C10H13BrO — CID 638219
(1S,3S,4R,5R,7R)-4-bromoadamantan-2-one (PubChem CID 638219) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is (1S,3S,4R,5R,7R)-4-bromoadamantan-2-one.
| Compound Name | (1S,3S,4R,5R,7R)-4-bromoadamantan-2-one |
|---|---|
| PubChem CID | 638219 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (1S,3S,4R,5R,7R)-4-bromoadamantan-2-one |
| SMILES | O=C1[C@H]2C[C@@H]3C[C@H](C2)[C@@H](Br)[C@H]1C3 |
| InChI | InChI=1S/C10H13BrO/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-9H,1-4H2/t5-,6+,7-,8+,9+/m0/s1 |
| InChIKey | FTYOJSPBIJRJOB-KVEIKIFDSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|