C10H12Br2O — CID 638220
(1R,3S,4S,9R)-4,9-dibromoadamantan-2-one (PubChem CID 638220) has the molecular formula C10H12Br2O and a molecular weight of 308.01 g/mol. Its IUPAC name is (1R,3S,4S,9R)-4,9-dibromoadamantan-2-one.
| Compound Name | (1R,3S,4S,9R)-4,9-dibromoadamantan-2-one |
|---|---|
| PubChem CID | 638220 |
| Molecular Formula | C10H12Br2O |
| Molecular Weight | 308.01 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | (1R,3S,4S,9R)-4,9-dibromoadamantan-2-one |
| SMILES | O=C1[C@H]2CC3CC([C@@H](Br)[C@H]1C3)[C@@H]2Br |
| InChI | InChI=1S/C10H12Br2O/c11-8-5-1-4-2-6(8)10(13)7(3-4)9(5)12/h4-9H,1-3H2/t4?,5?,6-,7+,8-,9+ |
| InChIKey | UYZFNMCEKDFJEC-PTWRQJBVSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.01 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|