C13H22N2O — CID 63822324
N-[cyano(cyclopropyl)methyl]-3,4,4-trimethylpentanamide (PubChem CID 63822324) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[cyano(cyclopropyl)methyl]-3,4,4-trimethylpentanamide.
| Compound Name | N-[cyano(cyclopropyl)methyl]-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 63822324 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[cyano(cyclopropyl)methyl]-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NC(C#N)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9(13(2,3)4)7-12(16)15-11(8-14)10-5-6-10/h9-11H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | HEYCKGHZOOQIEA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |