About 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide
4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide (PubChem CID 63824110) has the molecular formula C9H15N3OS
and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide.
Molecular Properties
| Compound Name | 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide |
| PubChem CID | 63824110 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide |
| SMILES | NCCCC(=O)NCCc1cscn1 |
| InChI | InChI=1S/C9H15N3OS/c10-4-1-2-9(13)11-5-3-8-6-14-7-12-8/h6-7H,1-5,10H2,(H,11,13) |
| InChIKey | DFGNSWSDGVRYEL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide?
The IUPAC name of 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide (CID 63824110) is 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide.
What is the SMILES notation for 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide?
The canonical SMILES for 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide is NCCCC(=O)NCCc1cscn1.
What is the InChIKey of 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide?
The InChIKey is DFGNSWSDGVRYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS/c10-4-1-2-9(13)11-5-3-8-6-14-7-12-8/h6-7H,1-5,10H2,(H,11,13).
What are the key properties of 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide?
4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide has a molecular weight of 213.31 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide is sourced from PubChem (CID 63824110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).