C10H17F3N4O3S — CID 63824958
3-amino-1-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide (PubChem CID 63824958) has the molecular formula C10H17F3N4O3S and a molecular weight of 330.33 g/mol. Its IUPAC name is 3-amino-1-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 63824958 |
| Molecular Formula | C10H17F3N4O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-amino-1-propyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCCOCC(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C10H17F3N4O3S/c1-2-4-17-6-8(9(14)16-17)21(18,19)15-3-5-20-7-10(11,12)13/h6,15H,2-5,7H2,1H3,(H2,14,16) |
| InChIKey | QJNMZPXJZJLJMN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|