C9H15F3N4O3S — CID 63824963
3-amino-1-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide (PubChem CID 63824963) has the molecular formula C9H15F3N4O3S and a molecular weight of 316.31 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 63824963 |
| Molecular Formula | C9H15F3N4O3S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-amino-1-ethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCOCC(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C9H15F3N4O3S/c1-2-16-5-7(8(13)15-16)20(17,18)14-3-4-19-6-9(10,11)12/h5,14H,2-4,6H2,1H3,(H2,13,15) |
| InChIKey | AFYULPLNVASTGU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|