About 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide
2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide (PubChem CID 63825433) has the molecular formula C11H11FN4OS
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide.
Molecular Properties
| Compound Name | 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide |
| PubChem CID | 63825433 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide |
| SMILES | NC(=O)c1cc(NCc2cscn2)c(F)cc1N |
| InChI | InChI=1S/C11H11FN4OS/c12-8-2-9(13)7(11(14)17)1-10(8)15-3-6-4-18-5-16-6/h1-2,4-5,15H,3,13H2,(H2,14,17) |
| InChIKey | RWXHZRQTFKRKNZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide?
The IUPAC name of 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide (CID 63825433) is 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide.
What is the SMILES notation for 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide?
The canonical SMILES for 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide is NC(=O)c1cc(NCc2cscn2)c(F)cc1N.
What is the InChIKey of 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide?
The InChIKey is RWXHZRQTFKRKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4OS/c12-8-2-9(13)7(11(14)17)1-10(8)15-3-6-4-18-5-16-6/h1-2,4-5,15H,3,13H2,(H2,14,17).
What are the key properties of 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide?
2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide has a molecular weight of 266.30 g/mol, XLogP of 1.58, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzamide is sourced from PubChem (CID 63825433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).