About 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine
6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine (PubChem CID 63825683) has the molecular formula C11H9FN4S
and a molecular weight of 248.29 g/mol. Its IUPAC name is 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine |
| PubChem CID | 63825683 |
| Molecular Formula | C11H9FN4S |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(F)cc2n1Cc1cscn1 |
| InChI | InChI=1S/C11H9FN4S/c12-7-1-2-9-10(3-7)16(11(13)15-9)4-8-5-17-6-14-8/h1-3,5-6H,4H2,(H2,13,15) |
| InChIKey | MBCMQPLOMDAWLL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine?
The IUPAC name of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine (CID 63825683) is 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine.
What is the SMILES notation for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine?
The canonical SMILES for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine is Nc1nc2ccc(F)cc2n1Cc1cscn1.
What is the InChIKey of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine?
The InChIKey is MBCMQPLOMDAWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN4S/c12-7-1-2-9-10(3-7)16(11(13)15-9)4-8-5-17-6-14-8/h1-3,5-6H,4H2,(H2,13,15).
What are the key properties of 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine?
6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine has a molecular weight of 248.29 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-(1,3-thiazol-4-ylmethyl)benzimidazol-2-amine is sourced from PubChem (CID 63825683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).