4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid

C13H13N3O3S — CID 63825750

IUPAC4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid
SMILESCc1ccc(C(=O)O)cc1NC(=O)NCc1cscn1
InChIInChI=1S/C13H13N3O3S/c1-8-2-3-9(12(17)18)4-11(8)16-13(19)14-5-10-6-20-7-15-10/h2-4,6-7H,5H2,1H3,(H,17,18)(H2,14,16,19)
InChIKeyMYKMOEDHWWKESL-UHFFFAOYSA-N
MW291.33 g/mol
LogP2.47
Rot. Bonds4

About 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid

4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid (PubChem CID 63825750) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid
PubChem CID63825750
Molecular FormulaC13H13N3O3S
Molecular Weight291.33 g/mol
Exact Mass291.07
IUPAC Name4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid
SMILESCc1ccc(C(=O)O)cc1NC(=O)NCc1cscn1
InChIInChI=1S/C13H13N3O3S/c1-8-2-3-9(12(17)18)4-11(8)16-13(19)14-5-10-6-20-7-15-10/h2-4,6-7H,5H2,1H3,(H,17,18)(H2,14,16,19)
InChIKeyMYKMOEDHWWKESL-UHFFFAOYSA-N
XLogP2.47
TPSA91.32 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.33
LogP ≤ 52.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid?
The IUPAC name of 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid (CID 63825750) is 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid.
What is the SMILES notation for 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid?
The canonical SMILES for 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid is Cc1ccc(C(=O)O)cc1NC(=O)NCc1cscn1.
What is the InChIKey of 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid?
The InChIKey is MYKMOEDHWWKESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3S/c1-8-2-3-9(12(17)18)4-11(8)16-13(19)14-5-10-6-20-7-15-10/h2-4,6-7H,5H2,1H3,(H,17,18)(H2,14,16,19).
What are the key properties of 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid?
4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid has a molecular weight of 291.33 g/mol, XLogP of 2.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid is sourced from PubChem (CID 63825750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).