C13H13N3O3S — CID 63825750
4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid (PubChem CID 63825750) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 63825750 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-methyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)NCc1cscn1 |
| InChI | InChI=1S/C13H13N3O3S/c1-8-2-3-9(12(17)18)4-11(8)16-13(19)14-5-10-6-20-7-15-10/h2-4,6-7H,5H2,1H3,(H,17,18)(H2,14,16,19) |
| InChIKey | MYKMOEDHWWKESL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |