C11H14F3N3O3 — CID 63826173
2-(5-amino-2-oxo-1-pyridinyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 63826173) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is 2-(5-amino-2-oxo-1-pyridinyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(5-amino-2-oxo-1-pyridinyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 63826173 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-(5-amino-2-oxo-1-pyridinyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | Nc1ccc(=O)n(CC(=O)NCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3N3O3/c12-11(13,14)7-20-4-3-16-9(18)6-17-5-8(15)1-2-10(17)19/h1-2,5H,3-4,6-7,15H2,(H,16,18) |
| InChIKey | LRFQYWKYTQHKIL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|