C16H23F2NO — CID 63826183
N-(2-cyclohexyloxyethyl)-1-(2,4-difluorophenyl)ethanamine (PubChem CID 63826183) has the molecular formula C16H23F2NO and a molecular weight of 283.36 g/mol. Its IUPAC name is N-(2-cyclohexyloxyethyl)-1-(2,4-difluorophenyl)ethanamine.
| Compound Name | N-(2-cyclohexyloxyethyl)-1-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 63826183 |
| Molecular Formula | C16H23F2NO |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-(2-cyclohexyloxyethyl)-1-(2,4-difluorophenyl)ethanamine |
| SMILES | CC(NCCOC1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NO/c1-12(15-8-7-13(17)11-16(15)18)19-9-10-20-14-5-3-2-4-6-14/h7-8,11-12,14,19H,2-6,9-10H2,1H3 |
| InChIKey | UTVGDKSIBPKQMN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|