C10H19F3N2O2 — CID 63826364
(2S)-2-amino-3,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butanamide (PubChem CID 63826364) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butanamide.
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 63826364 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]butanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-9(2,3)7(14)8(16)15-4-5-17-6-10(11,12)13/h7H,4-6,14H2,1-3H3,(H,15,16)/t7-/m1/s1 |
| InChIKey | QBSHDNVRCBAHSQ-SSDOTTSWSA-N |
| XLogP | 1.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|