C15H20ClNO2 — CID 63826472
2-chloro-N-(2-cyclopentyloxyethyl)-2-phenylacetamide (PubChem CID 63826472) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-chloro-N-(2-cyclopentyloxyethyl)-2-phenylacetamide.
| Compound Name | 2-chloro-N-(2-cyclopentyloxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 63826472 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-chloro-N-(2-cyclopentyloxyethyl)-2-phenylacetamide |
| SMILES | O=C(NCCOC1CCCC1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H20ClNO2/c16-14(12-6-2-1-3-7-12)15(18)17-10-11-19-13-8-4-5-9-13/h1-3,6-7,13-14H,4-5,8-11H2,(H,17,18) |
| InChIKey | RGUVBOJNRLAFHT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|