C8H14F3NO4S — CID 63826816
1,1-dioxo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]thiolan-3-ol (PubChem CID 63826816) has the molecular formula C8H14F3NO4S and a molecular weight of 277.26 g/mol. Its IUPAC name is 1,1-dioxo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]thiolan-3-ol |
|---|---|
| PubChem CID | 63826816 |
| Molecular Formula | C8H14F3NO4S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 1,1-dioxo-4-[2-(2,2,2-trifluoroethoxy)ethylamino]thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO4S/c9-8(10,11)5-16-2-1-12-6-3-17(14,15)4-7(6)13/h6-7,12-13H,1-5H2 |
| InChIKey | ZQPNCPVAXFNREM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|