C15H24N2O — CID 63826901
1-(2-cyclopentyloxyethyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 63826901) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(2-cyclopentyloxyethyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(2-cyclopentyloxyethyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 63826901 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-(2-cyclopentyloxyethyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | NC1CCCc2c1ccn2CCOC1CCCC1 |
| InChI | InChI=1S/C15H24N2O/c16-14-6-3-7-15-13(14)8-9-17(15)10-11-18-12-4-1-2-5-12/h8-9,12,14H,1-7,10-11,16H2 |
| InChIKey | FXACKCYGIYPIRB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |