C8H10F3N3O5S — CID 63826976
5-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid (PubChem CID 63826976) has the molecular formula C8H10F3N3O5S and a molecular weight of 317.25 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 63826976 |
| Molecular Formula | C8H10F3N3O5S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O5S/c9-8(10,11)4-19-2-1-13-20(17,18)6-5(7(15)16)3-12-14-6/h3,13H,1-2,4H2,(H,12,14)(H,15,16) |
| InChIKey | PVJGWEKDGQUBCQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|