C10H13F3N4O — CID 63827028
1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbonitrile (PubChem CID 63827028) has the molecular formula C10H13F3N4O and a molecular weight of 262.23 g/mol. Its IUPAC name is 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbonitrile.
| Compound Name | 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63827028 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1,3-dimethyl-5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(NCCOCC(F)(F)F)c1C#N |
| InChI | InChI=1S/C10H13F3N4O/c1-7-8(5-14)9(17(2)16-7)15-3-4-18-6-10(11,12)13/h15H,3-4,6H2,1-2H3 |
| InChIKey | LWNMLKGBSRYUQQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|