C12H15F3N4O — CID 63827045
5,6-dimethyl-7-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 63827045) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is 5,6-dimethyl-7-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-7-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63827045 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5,6-dimethyl-7-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(C)n(CCOCC(F)(F)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C12H15F3N4O/c1-7-8(2)19(3-4-20-5-12(13,14)15)11-9(7)10(16)17-6-18-11/h6H,3-5H2,1-2H3,(H2,16,17,18) |
| InChIKey | LFAQBGKUVVMNJP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|