About 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide
5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide (PubChem CID 63827100) has the molecular formula C10H15F3N2O3S2
and a molecular weight of 332.37 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide |
| PubChem CID | 63827100 |
| Molecular Formula | C10H15F3N2O3S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide |
| SMILES | NCCc1ccc(S(=O)(=O)NCCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H15F3N2O3S2/c11-10(12,13)7-18-6-5-15-20(16,17)9-2-1-8(19-9)3-4-14/h1-2,15H,3-7,14H2 |
| InChIKey | BJAZWLUBVYBDER-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide?
The IUPAC name of 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide (CID 63827100) is 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide?
The canonical SMILES for 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide is NCCc1ccc(S(=O)(=O)NCCOCC(F)(F)F)s1.
What is the InChIKey of 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide?
The InChIKey is BJAZWLUBVYBDER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O3S2/c11-10(12,13)7-18-6-5-15-20(16,17)9-2-1-8(19-9)3-4-14/h1-2,15H,3-7,14H2.
What are the key properties of 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide?
5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide has a molecular weight of 332.37 g/mol, XLogP of 1.11, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-sulfonamide is sourced from PubChem (CID 63827100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).