About 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine
5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine (PubChem CID 63827134) has the molecular formula C12H24F3NO
and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine |
| PubChem CID | 63827134 |
| Molecular Formula | C12H24F3NO |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine |
| SMILES | CCC(C)CC(CC)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO/c1-4-10(3)8-11(5-2)16-6-7-17-9-12(13,14)15/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | CDFHBIDNGVHYMJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine?
The IUPAC name of 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine (CID 63827134) is 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine.
What is the SMILES notation for 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine?
The canonical SMILES for 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine is CCC(C)CC(CC)NCCOCC(F)(F)F.
What is the InChIKey of 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine?
The InChIKey is CDFHBIDNGVHYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F3NO/c1-4-10(3)8-11(5-2)16-6-7-17-9-12(13,14)15/h10-11,16H,4-9H2,1-3H3.
What are the key properties of 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine?
5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine has a molecular weight of 255.32 g/mol, XLogP of 3.37, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]heptan-3-amine is sourced from PubChem (CID 63827134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).