C13H14F3N3O2 — CID 63827173
2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 63827173) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 63827173 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCOCC(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C13H14F3N3O2/c14-13(15,16)9-21-6-4-17-8-10-7-12(20)19-5-2-1-3-11(19)18-10/h1-3,5,7,17H,4,6,8-9H2 |
| InChIKey | NYHRWFWKWWAIRS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|