C10H19F3N2O3S — CID 63827272
1-piperidin-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]methanesulfonamide (PubChem CID 63827272) has the molecular formula C10H19F3N2O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 1-piperidin-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]methanesulfonamide.
| Compound Name | 1-piperidin-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 63827272 |
| Molecular Formula | C10H19F3N2O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-piperidin-2-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCCN1)NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O3S/c11-10(12,13)8-18-6-5-15-19(16,17)7-9-3-1-2-4-14-9/h9,14-15H,1-8H2 |
| InChIKey | FIQXTLBSQUTDEZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|