C12H14F3N3O2 — CID 63827282
5-amino-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-dihydroindol-2-one (PubChem CID 63827282) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 5-amino-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63827282 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-amino-6-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1NCCOCC(F)(F)F)NC(=O)C2 |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)6-20-2-1-17-10-5-9-7(3-8(10)16)4-11(19)18-9/h3,5,17H,1-2,4,6,16H2,(H,18,19) |
| InChIKey | FZKCGKPTFVUOHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|