C12H20F3NO3 — CID 63827310
N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 63827310) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 63827310 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | FC(F)(F)COCCNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H20F3NO3/c13-12(14,15)9-17-6-5-16-10-1-3-11(4-2-10)18-7-8-19-11/h10,16H,1-9H2 |
| InChIKey | ZYSRIAIVXJQFRY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|