C9H9BrF3NO6S — CID 63827504
5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]furan-2-carboxylic acid (PubChem CID 63827504) has the molecular formula C9H9BrF3NO6S and a molecular weight of 396.14 g/mol. Its IUPAC name is 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63827504 |
| Molecular Formula | C9H9BrF3NO6S |
| Molecular Weight | 396.14 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 5-bromo-4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCOCC(F)(F)F)c(Br)o1 |
| InChI | InChI=1S/C9H9BrF3NO6S/c10-7-6(3-5(20-7)8(15)16)21(17,18)14-1-2-19-4-9(11,12)13/h3,14H,1-2,4H2,(H,15,16) |
| InChIKey | PXRNTDHRLBHQCC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.14 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|