C10H15F3N2O2 — CID 63827520
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63827520) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63827520 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1nc(CNCCOCC(F)(F)F)oc1C |
| InChI | InChI=1S/C10H15F3N2O2/c1-7-8(2)17-9(15-7)5-14-3-4-16-6-10(11,12)13/h14H,3-6H2,1-2H3 |
| InChIKey | PQUOFEIWOGRQSZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|