About 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide
2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide (PubChem CID 63827591) has the molecular formula C8H15F3N2O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide.
Molecular Properties
| Compound Name | 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide |
| PubChem CID | 63827591 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide |
| SMILES | CC(C)(N)C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-7(2,12)6(14)13-3-4-15-5-8(9,10)11/h3-5,12H2,1-2H3,(H,13,14) |
| InChIKey | NXQYRWOYPJUPNK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide?
The IUPAC name of 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide (CID 63827591) is 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide.
What is the SMILES notation for 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide?
The canonical SMILES for 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide is CC(C)(N)C(=O)NCCOCC(F)(F)F.
What is the InChIKey of 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide?
The InChIKey is NXQYRWOYPJUPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2/c1-7(2,12)6(14)13-3-4-15-5-8(9,10)11/h3-5,12H2,1-2H3,(H,13,14).
What are the key properties of 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide?
2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide has a molecular weight of 228.21 g/mol, XLogP of 0.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propanamide is sourced from PubChem (CID 63827591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).