About 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine
2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine (PubChem CID 63827602) has the molecular formula C9H16F3N5O2
and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine |
| PubChem CID | 63827602 |
| Molecular Formula | C9H16F3N5O2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1nnnn1CCOCC(F)(F)F |
| InChI | InChI=1S/C9H16F3N5O2/c1-18-4-2-13-6-8-14-15-16-17(8)3-5-19-7-9(10,11)12/h13H,2-7H2,1H3 |
| InChIKey | IUSDEQNDCBOUKF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine?
The IUPAC name of 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine (CID 63827602) is 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine.
What is the SMILES notation for 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine?
The canonical SMILES for 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine is COCCNCc1nnnn1CCOCC(F)(F)F.
What is the InChIKey of 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine?
The InChIKey is IUSDEQNDCBOUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3N5O2/c1-18-4-2-13-6-8-14-15-16-17(8)3-5-19-7-9(10,11)12/h13H,2-7H2,1H3.
What are the key properties of 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine?
2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine has a molecular weight of 283.25 g/mol, XLogP of -0.01, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 63827602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).