C14H23F3N2OS — CID 63827653
1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 63827653) has the molecular formula C14H23F3N2OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 63827653 |
| Molecular Formula | C14H23F3N2OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(2-tert-butyl-4-methyl-1,3-thiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | Cc1nc(C(C)(C)C)sc1C(C)NCCOCC(F)(F)F |
| InChI | InChI=1S/C14H23F3N2OS/c1-9(18-6-7-20-8-14(15,16)17)11-10(2)19-12(21-11)13(3,4)5/h9,18H,6-8H2,1-5H3 |
| InChIKey | OZTVXUXMCCNVHY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|