About N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine
N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine (PubChem CID 63827735) has the molecular formula C12H12F3N3O
and a molecular weight of 271.24 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine.
Molecular Properties
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine |
| PubChem CID | 63827735 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine |
| SMILES | FC(F)(F)COCCNc1cnnc2ccccc12 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)8-19-6-5-16-11-7-17-18-10-4-2-1-3-9(10)11/h1-4,7H,5-6,8H2,(H,16,18) |
| InChIKey | FPFOBMYALBPXBD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine?
The IUPAC name of N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine (CID 63827735) is N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine.
What is the SMILES notation for N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine?
The canonical SMILES for N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine is FC(F)(F)COCCNc1cnnc2ccccc12.
What is the InChIKey of N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine?
The InChIKey is FPFOBMYALBPXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3O/c13-12(14,15)8-19-6-5-16-11-7-17-18-10-4-2-1-3-9(10)11/h1-4,7H,5-6,8H2,(H,16,18).
What are the key properties of N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine?
N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine has a molecular weight of 271.24 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2,2-trifluoroethoxy)ethyl]cinnolin-4-amine is sourced from PubChem (CID 63827735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).