C9H10Br2F3NO2 — CID 63827829
N-[(4,5-dibromofuran-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63827829) has the molecular formula C9H10Br2F3NO2 and a molecular weight of 380.99 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63827829 |
| Molecular Formula | C9H10Br2F3NO2 |
| Molecular Weight | 380.99 g/mol |
| Exact Mass | 378.90 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | FC(F)(F)COCCNCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C9H10Br2F3NO2/c10-7-3-6(17-8(7)11)4-15-1-2-16-5-9(12,13)14/h3,15H,1-2,4-5H2 |
| InChIKey | IGQSORRAUFFZIM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|