About 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine
2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine (PubChem CID 63827946) has the molecular formula C10H18F3N5O
and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine |
| PubChem CID | 63827946 |
| Molecular Formula | C10H18F3N5O |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1nnnn1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H18F3N5O/c1-8(2)5-14-6-9-15-16-17-18(9)3-4-19-7-10(11,12)13/h8,14H,3-7H2,1-2H3 |
| InChIKey | WOFJKWQXPLVNND-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine?
The IUPAC name of 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine (CID 63827946) is 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine.
What is the SMILES notation for 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine?
The canonical SMILES for 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine is CC(C)CNCc1nnnn1CCOCC(F)(F)F.
What is the InChIKey of 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine?
The InChIKey is WOFJKWQXPLVNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N5O/c1-8(2)5-14-6-9-15-16-17-18(9)3-4-19-7-10(11,12)13/h8,14H,3-7H2,1-2H3.
What are the key properties of 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine?
2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine has a molecular weight of 281.28 g/mol, XLogP of 1.00, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[[1-[2-(2,2,2-trifluoroethoxy)ethyl]tetrazol-5-yl]methyl]propan-1-amine is sourced from PubChem (CID 63827946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).