C9H15F3N4O — CID 63828161
1,3-dimethyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine (PubChem CID 63828161) has the molecular formula C9H15F3N4O and a molecular weight of 252.24 g/mol. Its IUPAC name is 1,3-dimethyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine.
| Compound Name | 1,3-dimethyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 63828161 |
| Molecular Formula | C9H15F3N4O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1,3-dimethyl-5-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-4,5-diamine |
| SMILES | Cc1nn(C)c(NCCOCC(F)(F)F)c1N |
| InChI | InChI=1S/C9H15F3N4O/c1-6-7(13)8(16(2)15-6)14-3-4-17-5-9(10,11)12/h14H,3-5,13H2,1-2H3 |
| InChIKey | HJAGAOBDJWMDSV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|