C13H13F3N2OS — CID 63828641
4-phenyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione (PubChem CID 63828641) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-phenyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione.
| Compound Name | 4-phenyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 63828641 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-phenyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-imidazole-2-thione |
| SMILES | FC(F)(F)COCCn1c(-c2ccccc2)c[nH]c1=S |
| InChI | InChI=1S/C13H13F3N2OS/c14-13(15,16)9-19-7-6-18-11(8-17-12(18)20)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,17,20) |
| InChIKey | VDSDVLQDIXRBID-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|