C11H16F3N3O2 — CID 63828797
1-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazin-2-one (PubChem CID 63828797) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazin-2-one.
| Compound Name | 1-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 63828797 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-propan-2-yl-3-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrazin-2-one |
| SMILES | CC(C)n1ccnc(NCCOCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H16F3N3O2/c1-8(2)17-5-3-15-9(10(17)18)16-4-6-19-7-11(12,13)14/h3,5,8H,4,6-7H2,1-2H3,(H,15,16) |
| InChIKey | NSJPGYDKQVTZKN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|