About N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide
N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide (PubChem CID 63829021) has the molecular formula C8H16F3N3O3S
and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide |
| PubChem CID | 63829021 |
| Molecular Formula | C8H16F3N3O3S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C8H16F3N3O3S/c9-8(10,11)7-17-6-3-13-18(15,16)14-4-1-12-2-5-14/h12-13H,1-7H2 |
| InChIKey | AXICZYSNWOYEJM-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide?
The IUPAC name of N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide (CID 63829021) is N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide.
What is the SMILES notation for N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide?
The canonical SMILES for N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide is O=S(=O)(NCCOCC(F)(F)F)N1CCNCC1.
What is the InChIKey of N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide?
The InChIKey is AXICZYSNWOYEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3N3O3S/c9-8(10,11)7-17-6-3-13-18(15,16)14-4-1-12-2-5-14/h12-13H,1-7H2.
What are the key properties of N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide?
N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide has a molecular weight of 291.30 g/mol, XLogP of -0.70, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-sulfonamide is sourced from PubChem (CID 63829021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).