C13H16F3N3OS — CID 63829073
N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63829073) has the molecular formula C13H16F3N3OS and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63829073 |
| Molecular Formula | C13H16F3N3OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[(1-methylimidazol-2-yl)-thiophen-2-ylmethyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cn1ccnc1C(NCCOCC(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C13H16F3N3OS/c1-19-6-4-18-12(19)11(10-3-2-8-21-10)17-5-7-20-9-13(14,15)16/h2-4,6,8,11,17H,5,7,9H2,1H3 |
| InChIKey | HIIGBVRYYUNSQX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|