C9H12F3N3O5S — CID 63829095
2-[4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 63829095) has the molecular formula C9H12F3N3O5S and a molecular weight of 331.27 g/mol. Its IUPAC name is 2-[4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 63829095 |
| Molecular Formula | C9H12F3N3O5S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethylsulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(S(=O)(=O)NCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H12F3N3O5S/c10-9(11,12)6-20-2-1-14-21(18,19)7-3-13-15(4-7)5-8(16)17/h3-4,14H,1-2,5-6H2,(H,16,17) |
| InChIKey | MCXIYPKUOJMESW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|