About N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine
N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine (PubChem CID 63829803) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine |
| PubChem CID | 63829803 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine |
| SMILES | CCNCC(C)CNCC1(C)CCCC1 |
| InChI | InChI=1S/C13H28N2/c1-4-14-9-12(2)10-15-11-13(3)7-5-6-8-13/h12,14-15H,4-11H2,1-3H3 |
| InChIKey | OOUTURUFNGFZSK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine?
The IUPAC name of N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine (CID 63829803) is N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine.
What is the SMILES notation for N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine?
The canonical SMILES for N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine is CCNCC(C)CNCC1(C)CCCC1.
What is the InChIKey of N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine?
The InChIKey is OOUTURUFNGFZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-4-14-9-12(2)10-15-11-13(3)7-5-6-8-13/h12,14-15H,4-11H2,1-3H3.
What are the key properties of N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine?
N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine has a molecular weight of 212.38 g/mol, XLogP of 2.40, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methyl-N'-[(1-methylcyclopentyl)methyl]propane-1,3-diamine is sourced from PubChem (CID 63829803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).